C28H25IrN2O2- — CID 176878607
(Z)-4-hydroxypent-3-en-2-one;iridium;3-(6-propan-2-ylisoquinolin-1-yl)-4H-naphthalen-4-ide-1-carbonitrile (PubChem CID 176878607) has the molecular formula C28H25IrN2O2- and a molecular weight of 613.74 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;3-(6-propan-2-ylisoquinolin-1-yl)-4H-naphthalen-4-ide-1-carbonitrile.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;3-(6-propan-2-ylisoquinolin-1-yl)-4H-naphthalen-4-ide-1-carbonitrile |
|---|---|
| PubChem CID | 176878607 |
| Molecular Formula | C28H25IrN2O2- |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;3-(6-propan-2-ylisoquinolin-1-yl)-4H-naphthalen-4-ide-1-carbonitrile |
| SMILES | CC(=O)/C=C(/C)O.CC(C)c1ccc2c(-c3[c-]c4ccccc4c(C#N)c3)nccc2c1.[Ir] |
| InChI | InChI=1S/C23H17N2.C5H8O2.Ir/c1-15(2)16-7-8-22-18(11-16)9-10-25-23(22)19-12-17-5-3-4-6-21(17)20(13-19)14-24;1-4(6)3-5(2)7;/h3-11,13,15H,1-2H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | XBFCYIOZYPUNEN-LWFKIUJUSA-N |
| XLogP | 6.88 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|