C39H35GeIrN2O2- — CID 177293388
(Z)-4-hydroxypent-3-en-2-one;iridium;3-[8-methyl-7-(4-trimethylgermylphenyl)benzo[f]isoquinolin-4-yl]-4H-naphthalen-4-ide-1-carbonitrile (PubChem CID 177293388) has the molecular formula C39H35GeIrN2O2- and a molecular weight of 828.55 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;3-[8-methyl-7-(4-trimethylgermylphenyl)benzo[f]isoquinolin-4-yl]-4H-naphthalen-4-ide-1-carbonitrile.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;3-[8-methyl-7-(4-trimethylgermylphenyl)benzo[f]isoquinolin-4-yl]-4H-naphthalen-4-ide-1-carbonitrile |
|---|---|
| PubChem CID | 177293388 |
| Molecular Formula | C39H35GeIrN2O2- |
| Molecular Weight | 828.55 g/mol |
| Exact Mass | 830.15 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;3-[8-methyl-7-(4-trimethylgermylphenyl)benzo[f]isoquinolin-4-yl]-4H-naphthalen-4-ide-1-carbonitrile |
| SMILES | CC(=O)/C=C(/C)O.Cc1ccc2c(ccc3c(-c4[c-]c5ccccc5c(C#N)c4)nccc32)c1-c1ccc([Ge](C)(C)C)cc1.[Ir] |
| InChI | InChI=1S/C34H27GeN2.C5H8O2.Ir/c1-22-9-14-29-30-17-18-37-34(25-19-24-7-5-6-8-28(24)26(20-25)21-36)32(30)16-15-31(29)33(22)23-10-12-27(13-11-23)35(2,3)4;1-4(6)3-5(2)7;/h5-18,20H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | VOHNTYRFSAYQGM-LWFKIUJUSA-N |
| XLogP | 9.44 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.55 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|