C46H49IrN2O2Si- — CID 177293384
(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium;3-[7-(4-trimethylsilylphenyl)benzo[f]isoquinolin-4-yl]-4H-naphthalen-4-ide-1-carbonitrile (PubChem CID 177293384) has the molecular formula C46H49IrN2O2Si- and a molecular weight of 882.21 g/mol. Its IUPAC name is (Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium;3-[7-(4-trimethylsilylphenyl)benzo[f]isoquinolin-4-yl]-4H-naphthalen-4-ide-1-carbonitrile.
| Compound Name | (Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium;3-[7-(4-trimethylsilylphenyl)benzo[f]isoquinolin-4-yl]-4H-naphthalen-4-ide-1-carbonitrile |
|---|---|
| PubChem CID | 177293384 |
| Molecular Formula | C46H49IrN2O2Si- |
| Molecular Weight | 882.21 g/mol |
| Exact Mass | 882.32 |
| IUPAC Name | (Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium;3-[7-(4-trimethylsilylphenyl)benzo[f]isoquinolin-4-yl]-4H-naphthalen-4-ide-1-carbonitrile |
| SMILES | CCC(C)(C)C(=O)/C=C(\O)C(C)(C)CC.C[Si](C)(C)c1ccc(-c2cccc3c2ccc2c(-c4[c-]c5ccccc5c(C#N)c4)nccc23)cc1.[Ir] |
| InChI | InChI=1S/C33H25N2Si.C13H24O2.Ir/c1-36(2,3)26-13-11-22(12-14-26)28-9-6-10-29-30(28)15-16-32-31(29)17-18-35-33(32)24-19-23-7-4-5-8-27(23)25(20-24)21-34;1-7-12(3,4)10(14)9-11(15)13(5,6)8-2;/h4-18,20H,1-3H3;9,14H,7-8H2,1-6H3;/q-1;;/b;10-9-; |
| InChIKey | FDWLREGNJJZCBY-MEILSSRFSA-N |
| XLogP | 11.96 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.21 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|