C45H45F3IrNO2- — CID 170520714
8-(2,6-dimethylphenyl)-4-[4-(trifluoromethyl)-1H-naphthalen-1-id-2-yl]benzo[f]isoquinoline;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium (PubChem CID 170520714) has the molecular formula C45H45F3IrNO2- and a molecular weight of 881.07 g/mol. Its IUPAC name is 8-(2,6-dimethylphenyl)-4-[4-(trifluoromethyl)-1H-naphthalen-1-id-2-yl]benzo[f]isoquinoline;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium.
| Compound Name | 8-(2,6-dimethylphenyl)-4-[4-(trifluoromethyl)-1H-naphthalen-1-id-2-yl]benzo[f]isoquinoline;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 170520714 |
| Molecular Formula | C45H45F3IrNO2- |
| Molecular Weight | 881.07 g/mol |
| Exact Mass | 881.30 |
| IUPAC Name | 8-(2,6-dimethylphenyl)-4-[4-(trifluoromethyl)-1H-naphthalen-1-id-2-yl]benzo[f]isoquinoline;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium |
| SMILES | CCC(C)(C)C(=O)/C=C(\O)C(C)(C)CC.Cc1cccc(C)c1-c1ccc2c(ccc3c(-c4[c-]c5ccccc5c(C(F)(F)F)c4)nccc32)c1.[Ir] |
| InChI | InChI=1S/C32H21F3N.C13H24O2.Ir/c1-19-6-5-7-20(2)30(19)23-11-12-25-22(16-23)10-13-28-27(25)14-15-36-31(28)24-17-21-8-3-4-9-26(21)29(18-24)32(33,34)35;1-7-12(3,4)10(14)9-11(15)13(5,6)8-2;/h3-16,18H,1-2H3;9,14H,7-8H2,1-6H3;/q-1;;/b;10-9-; |
| InChIKey | WKZCUSFUBKMFGE-MEILSSRFSA-N |
| XLogP | 13.18 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.07 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|