C36H38IrNO2- — CID 162482605
(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium;1-(1H-naphthalen-1-id-2-yl)benzo[h]isoquinoline (PubChem CID 162482605) has the molecular formula C36H38IrNO2- and a molecular weight of 708.92 g/mol. Its IUPAC name is (Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium;1-(1H-naphthalen-1-id-2-yl)benzo[h]isoquinoline.
| Compound Name | (Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium;1-(1H-naphthalen-1-id-2-yl)benzo[h]isoquinoline |
|---|---|
| PubChem CID | 162482605 |
| Molecular Formula | C36H38IrNO2- |
| Molecular Weight | 708.92 g/mol |
| Exact Mass | 709.25 |
| IUPAC Name | (Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium;1-(1H-naphthalen-1-id-2-yl)benzo[h]isoquinoline |
| SMILES | CCC(C)(C)C(=O)/C=C(\O)C(C)(C)CC.[Ir].[c-]1c(-c2nccc3ccc4ccccc4c23)ccc2ccccc12 |
| InChI | InChI=1S/C23H14N.C13H24O2.Ir/c1-2-7-19-15-20(12-9-16(19)5-1)23-22-18(13-14-24-23)11-10-17-6-3-4-8-21(17)22;1-7-12(3,4)10(14)9-11(15)13(5,6)8-2;/h1-14H;9,14H,7-8H2,1-6H3;/q-1;;/b;10-9-; |
| InChIKey | ZANWUVLWPICFLC-MEILSSRFSA-N |
| XLogP | 9.88 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.92 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|