C38H48GeIrNO3- — CID 176607028
CID 176607028 (PubChem CID 176607028) has the molecular formula C38H48GeIrNO3- and a molecular weight of 831.63 g/mol.
| Compound Name | CID 176607028 |
|---|---|
| PubChem CID | 176607028 |
| Molecular Formula | C38H48GeIrNO3- |
| Molecular Weight | 831.63 g/mol |
| Exact Mass | 833.25 |
| IUPAC Name | — |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.Cc1c2c([c-]c3ccccc13)-c1nccc3ccc([Ge](C)(C)C)c(c13)O2.[Ir] |
| InChI | InChI=1S/C23H20GeNO.C15H28O2.Ir/c1-14-17-8-6-5-7-16(17)13-18-21-20-15(11-12-25-21)9-10-19(24(2,3)4)23(20)26-22(14)18;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h5-12H,1-4H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-; |
| InChIKey | WGAIJESPEGBBDZ-SWPBDETKSA-N |
| XLogP | 10.46 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.63 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|