C39H42IrNO3- — CID 176851450
CID 176851450 (PubChem CID 176851450) has the molecular formula C39H42IrNO3- and a molecular weight of 764.99 g/mol.
| Compound Name | CID 176851450 |
|---|---|
| PubChem CID | 176851450 |
| Molecular Formula | C39H42IrNO3- |
| Molecular Weight | 764.99 g/mol |
| Exact Mass | 765.28 |
| IUPAC Name | — |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.Cc1c2c([c-]c3ccccc13)-c1nccc3cc4ccccc4c(c13)O2.[Ir] |
| InChI | InChI=1S/C24H14NO.C15H28O2.Ir/c1-14-18-8-4-2-7-16(18)13-20-22-21-17(10-11-25-22)12-15-6-3-5-9-19(15)24(21)26-23(14)20;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h2-12H,1H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-; |
| InChIKey | RIVFIGSAPNOBKA-SWPBDETKSA-N |
| XLogP | 11.07 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.99 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|