About CID 167365929
CID 167365929 (PubChem CID 167365929) has the molecular formula C37H45IrN2O3-
and a molecular weight of 758.00 g/mol.
Molecular Properties
| Compound Name | CID 167365929 |
| PubChem CID | 167365929 |
| Molecular Formula | C37H45IrN2O3- |
| Molecular Weight | 758.00 g/mol |
| Exact Mass | 758.31 |
| IUPAC Name | — |
| SMILES | CCC(CC)/C(O)=C/C(=O)C(C)(CC)CC.Cc1c2c([c-]c3ccccc13)-c1ncnc3cc(CC(C)C)cc(c13)O2.[Ir] |
| InChI | InChI=1S/C23H19N2O.C14H26O2.Ir/c1-13(2)8-15-9-19-21-20(10-15)26-23-14(3)17-7-5-4-6-16(17)11-18(23)22(21)25-12-24-19;1-6-11(7-2)12(15)10-13(16)14(5,8-3)9-4;/h4-7,9-10,12-13H,8H2,1-3H3;10-11,15H,6-9H2,1-5H3;/q-1;;/b;12-10-; |
| InChIKey | UVLOEEMHRSHKMN-YESGYARDSA-N |
| XLogP | 10.12 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 758.00 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 167365929 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167365929?
The IUPAC name of CID 167365929 (CID 167365929) is not available.
What is the SMILES notation for CID 167365929?
The canonical SMILES for CID 167365929 is CCC(CC)/C(O)=C/C(=O)C(C)(CC)CC.Cc1c2c([c-]c3ccccc13)-c1ncnc3cc(CC(C)C)cc(c13)O2.[Ir].
What is the InChIKey of CID 167365929?
The InChIKey is UVLOEEMHRSHKMN-YESGYARDSA-N. The full InChI is InChI=1S/C23H19N2O.C14H26O2.Ir/c1-13(2)8-15-9-19-21-20(10-15)26-23-14(3)17-7-5-4-6-16(17)11-18(23)22(21)25-12-24-19;1-6-11(7-2)12(15)10-13(16)14(5,8-3)9-4;/h4-7,9-10,12-13H,8H2,1-3H3;10-11,15H,6-9H2,1-5H3;/q-1;;/b;12-10-;.
What are the key properties of CID 167365929?
CID 167365929 has a molecular weight of 758.00 g/mol, XLogP of 10.12, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167365929 is sourced from PubChem (CID 167365929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).