C41H48IrNO3- — CID 176851677
(Z)-3,7-diethyl-6-hydroxy-3-methylnon-5-en-4-one;1-[4-(2,2-dimethylpropyl)-1H-naphthalen-1-id-2-yl]indeno[1,2-c]pyridin-5-one;iridium (PubChem CID 176851677) has the molecular formula C41H48IrNO3- and a molecular weight of 795.06 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxy-3-methylnon-5-en-4-one;1-[4-(2,2-dimethylpropyl)-1H-naphthalen-1-id-2-yl]indeno[1,2-c]pyridin-5-one;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxy-3-methylnon-5-en-4-one;1-[4-(2,2-dimethylpropyl)-1H-naphthalen-1-id-2-yl]indeno[1,2-c]pyridin-5-one;iridium |
|---|---|
| PubChem CID | 176851677 |
| Molecular Formula | C41H48IrNO3- |
| Molecular Weight | 795.06 g/mol |
| Exact Mass | 795.33 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxy-3-methylnon-5-en-4-one;1-[4-(2,2-dimethylpropyl)-1H-naphthalen-1-id-2-yl]indeno[1,2-c]pyridin-5-one;iridium |
| SMILES | CC(C)(C)Cc1cc(-c2nccc3c2-c2ccccc2C3=O)[c-]c2ccccc12.CCC(CC)/C(O)=C/C(=O)C(C)(CC)CC.[Ir] |
| InChI | InChI=1S/C27H22NO.C14H26O2.Ir/c1-27(2,3)16-19-15-18(14-17-8-4-5-9-20(17)19)25-24-21-10-6-7-11-22(21)26(29)23(24)12-13-28-25;1-6-11(7-2)12(15)10-13(16)14(5,8-3)9-4;/h4-13,15H,16H2,1-3H3;10-11,15H,6-9H2,1-5H3;/q-1;;/b;12-10-; |
| InChIKey | CFGLNYJCLQFMLW-YESGYARDSA-N |
| XLogP | 10.76 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.06 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|