C39H52IrNO2S- — CID 168852958
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;2-(2,2-dimethylpropyl)-3-methyl-7-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]pyridine;iridium (PubChem CID 168852958) has the molecular formula C39H52IrNO2S- and a molecular weight of 791.13 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;2-(2,2-dimethylpropyl)-3-methyl-7-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]pyridine;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;2-(2,2-dimethylpropyl)-3-methyl-7-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]pyridine;iridium |
|---|---|
| PubChem CID | 168852958 |
| Molecular Formula | C39H52IrNO2S- |
| Molecular Weight | 791.13 g/mol |
| Exact Mass | 791.34 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;2-(2,2-dimethylpropyl)-3-methyl-7-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]pyridine;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1c(CC(C)(C)C)sc2c(-c3[c-]c4ccccc4c(C(C)C)c3)nccc12.[Ir] |
| InChI | InChI=1S/C26H28NS.C13H24O2.Ir/c1-16(2)22-14-19(13-18-9-7-8-10-21(18)22)24-25-20(11-12-27-24)17(3)23(28-25)15-26(4,5)6;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h7-12,14,16H,15H2,1-6H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | FGXZVVSUNCVUEE-DZTQYQPZSA-N |
| XLogP | 11.80 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.13 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|