C33H41FIrNO2SSi- — CID 176751508
(Z)-5-ethyl-1-fluoro-4-hydroxyhept-3-en-2-one;iridium;trimethyl-[3-methyl-7-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]pyridin-2-yl]silane (PubChem CID 176751508) has the molecular formula C33H41FIrNO2SSi- and a molecular weight of 755.06 g/mol. Its IUPAC name is (Z)-5-ethyl-1-fluoro-4-hydroxyhept-3-en-2-one;iridium;trimethyl-[3-methyl-7-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]pyridin-2-yl]silane.
| Compound Name | (Z)-5-ethyl-1-fluoro-4-hydroxyhept-3-en-2-one;iridium;trimethyl-[3-methyl-7-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]pyridin-2-yl]silane |
|---|---|
| PubChem CID | 176751508 |
| Molecular Formula | C33H41FIrNO2SSi- |
| Molecular Weight | 755.06 g/mol |
| Exact Mass | 755.22 |
| IUPAC Name | (Z)-5-ethyl-1-fluoro-4-hydroxyhept-3-en-2-one;iridium;trimethyl-[3-methyl-7-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]pyridin-2-yl]silane |
| SMILES | CCC(CC)/C(O)=C/C(=O)CF.Cc1c([Si](C)(C)C)sc2c(-c3[c-]c4ccccc4c(C(C)C)c3)nccc12.[Ir] |
| InChI | InChI=1S/C24H26NSSi.C9H15FO2.Ir/c1-15(2)21-14-18(13-17-9-7-8-10-20(17)21)22-23-19(11-12-25-22)16(3)24(26-23)27(4,5)6;1-3-7(4-2)9(12)5-8(11)6-10;/h7-12,14-15H,1-6H3;5,7,12H,3-4,6H2,1-2H3;/q-1;;/b;9-5-; |
| InChIKey | ZEDYPBDDSOVLBA-PJDKWVILSA-N |
| XLogP | 9.29 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.06 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|