C46H68IrNO2SSi- — CID 170660350
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;[3-methyl-7-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]pyridin-2-yl]-tris(2-methylpropyl)silane (PubChem CID 170660350) has the molecular formula C46H68IrNO2SSi- and a molecular weight of 919.42 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;[3-methyl-7-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]pyridin-2-yl]-tris(2-methylpropyl)silane.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;[3-methyl-7-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]pyridin-2-yl]-tris(2-methylpropyl)silane |
|---|---|
| PubChem CID | 170660350 |
| Molecular Formula | C46H68IrNO2SSi- |
| Molecular Weight | 919.42 g/mol |
| Exact Mass | 919.44 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;[3-methyl-7-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]pyridin-2-yl]-tris(2-methylpropyl)silane |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1c([Si](CC(C)C)(CC(C)C)CC(C)C)sc2c(-c3[c-]c4ccccc4c(C(C)C)c3)nccc12.[Ir] |
| InChI | InChI=1S/C33H44NSSi.C13H24O2.Ir/c1-21(2)18-36(19-22(3)4,20-23(5)6)33-25(9)28-14-15-34-31(32(28)35-33)27-16-26-12-10-11-13-29(26)30(17-27)24(7)8;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h10-15,17,21-24H,18-20H2,1-9H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | BPQYFAWFPBZAMN-DZTQYQPZSA-N |
| XLogP | 13.84 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.42 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|