C37H37FIrNO2- — CID 171435639
7-fluoro-5-methyl-1-(1H-naphthalen-1-id-2-yl)-6-phenylisoquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium (PubChem CID 171435639) has the molecular formula C37H37FIrNO2- and a molecular weight of 738.92 g/mol. Its IUPAC name is 7-fluoro-5-methyl-1-(1H-naphthalen-1-id-2-yl)-6-phenylisoquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium.
| Compound Name | 7-fluoro-5-methyl-1-(1H-naphthalen-1-id-2-yl)-6-phenylisoquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 171435639 |
| Molecular Formula | C37H37FIrNO2- |
| Molecular Weight | 738.92 g/mol |
| Exact Mass | 739.24 |
| IUPAC Name | 7-fluoro-5-methyl-1-(1H-naphthalen-1-id-2-yl)-6-phenylisoquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1c(-c2ccccc2)c(F)cc2c(-c3[c-]c4ccccc4cc3)nccc12.[Ir] |
| InChI | InChI=1S/C26H17FN.C11H20O2.Ir/c1-17-22-13-14-28-26(21-12-11-18-7-5-6-10-20(18)15-21)23(22)16-24(27)25(17)19-8-3-2-4-9-19;1-10(2,3)8(12)7-9(13)11(4,5)6;/h2-14,16H,1H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | CCPPNAXUUCPLKA-HXIBTQJOSA-N |
| XLogP | 10.06 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.92 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|