About CID 176880998
CID 176880998 (PubChem CID 176880998) has the molecular formula C46H43IrN2O2-
and a molecular weight of 848.08 g/mol.
Molecular Properties
| Compound Name | CID 176880998 |
| PubChem CID | 176880998 |
| Molecular Formula | C46H43IrN2O2- |
| Molecular Weight | 848.08 g/mol |
| Exact Mass | 848.30 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1cc2ccc3c4ccnc5c4c(cc3c2cc1C)N(c1ccccc1)c1cc2ccccc2[c-]c1-5.[Ir] |
| InChI | InChI=1S/C35H23N2.C11H20O2.Ir/c1-21-16-25-12-13-27-28-14-15-36-35-31-18-23-8-6-7-9-24(23)19-32(31)37(26-10-4-3-5-11-26)33(34(28)35)20-30(27)29(25)17-22(21)2;1-10(2,3)8(12)7-9(13)11(4,5)6;/h3-17,19-20H,1-2H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | ANBRNSHKKJAHIV-HXIBTQJOSA-N |
| XLogP | 12.65 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 848.08 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176880998 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176880998?
The IUPAC name of CID 176880998 (CID 176880998) is not available.
What is the SMILES notation for CID 176880998?
The canonical SMILES for CID 176880998 is CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1cc2ccc3c4ccnc5c4c(cc3c2cc1C)N(c1ccccc1)c1cc2ccccc2[c-]c1-5.[Ir].
What is the InChIKey of CID 176880998?
The InChIKey is ANBRNSHKKJAHIV-HXIBTQJOSA-N. The full InChI is InChI=1S/C35H23N2.C11H20O2.Ir/c1-21-16-25-12-13-27-28-14-15-36-35-31-18-23-8-6-7-9-24(23)19-32(31)37(26-10-4-3-5-11-26)33(34(28)35)20-30(27)29(25)17-22(21)2;1-10(2,3)8(12)7-9(13)11(4,5)6;/h3-17,19-20H,1-2H3;7,12H,1-6H3;/q-1;;/b;8-7-;.
What are the key properties of CID 176880998?
CID 176880998 has a molecular weight of 848.08 g/mol, XLogP of 12.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176880998 is sourced from PubChem (CID 176880998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).