About CID 176881060
CID 176881060 (PubChem CID 176881060) has the molecular formula C42H43IrN2O3-
and a molecular weight of 816.03 g/mol.
Molecular Properties
| Compound Name | CID 176881060 |
| PubChem CID | 176881060 |
| Molecular Formula | C42H43IrN2O3- |
| Molecular Weight | 816.03 g/mol |
| Exact Mass | 816.29 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1nc(CC(C)C)cc2c1ccc1c3ccnc4c3c(cc21)Oc1cc2ccccc2[c-]c1-4.[Ir] |
| InChI | InChI=1S/C31H23N2O.C11H20O2.Ir/c1-17(2)12-21-15-25-22(18(3)33-21)8-9-23-24-10-11-32-31-27-13-19-6-4-5-7-20(19)14-28(27)34-29(30(24)31)16-26(23)25;1-10(2,3)8(12)7-9(13)11(4,5)6;/h4-11,14-17H,12H2,1-3H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | CXXRAFGUSVJZQQ-HXIBTQJOSA-N |
| XLogP | 11.26 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 816.03 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176881060 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176881060?
The IUPAC name of CID 176881060 (CID 176881060) is not available.
What is the SMILES notation for CID 176881060?
The canonical SMILES for CID 176881060 is CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1nc(CC(C)C)cc2c1ccc1c3ccnc4c3c(cc21)Oc1cc2ccccc2[c-]c1-4.[Ir].
What is the InChIKey of CID 176881060?
The InChIKey is CXXRAFGUSVJZQQ-HXIBTQJOSA-N. The full InChI is InChI=1S/C31H23N2O.C11H20O2.Ir/c1-17(2)12-21-15-25-22(18(3)33-21)8-9-23-24-10-11-32-31-27-13-19-6-4-5-7-20(19)14-28(27)34-29(30(24)31)16-26(23)25;1-10(2,3)8(12)7-9(13)11(4,5)6;/h4-11,14-17H,12H2,1-3H3;7,12H,1-6H3;/q-1;;/b;8-7-;.
What are the key properties of CID 176881060?
CID 176881060 has a molecular weight of 816.03 g/mol, XLogP of 11.26, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176881060 is sourced from PubChem (CID 176881060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).