About CID 176880792
CID 176880792 (PubChem CID 176880792) has the molecular formula C31H22IrNO-
and a molecular weight of 616.74 g/mol.
Molecular Properties
| Compound Name | CID 176880792 |
| PubChem CID | 176880792 |
| Molecular Formula | C31H22IrNO- |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | — |
| SMILES | CC(C)Cc1ccc2ccc3c4ccnc5c4c(cc3c2c1)Oc1cc2ccccc2[c-]c1-5.[Ir] |
| InChI | InChI=1S/C31H22NO.Ir/c1-18(2)13-19-7-8-20-9-10-23-24-11-12-32-31-27-15-21-5-3-4-6-22(21)16-28(27)33-29(30(24)31)17-26(23)25(20)14-19;/h3-12,14,16-18H,13H2,1-2H3;/q-1; |
| InChIKey | OZCRSDSVYFSCMQ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176880792 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176880792?
The IUPAC name of CID 176880792 (CID 176880792) is not available.
What is the SMILES notation for CID 176880792?
The canonical SMILES for CID 176880792 is CC(C)Cc1ccc2ccc3c4ccnc5c4c(cc3c2c1)Oc1cc2ccccc2[c-]c1-5.[Ir].
What is the InChIKey of CID 176880792?
The InChIKey is OZCRSDSVYFSCMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H22NO.Ir/c1-18(2)13-19-7-8-20-9-10-23-24-11-12-32-31-27-15-21-5-3-4-6-22(21)16-28(27)33-29(30(24)31)17-26(23)25(20)14-19;/h3-12,14,16-18H,13H2,1-2H3;/q-1;.
What are the key properties of CID 176880792?
CID 176880792 has a molecular weight of 616.74 g/mol, XLogP of 8.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176880792 is sourced from PubChem (CID 176880792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).