About CID 176881039
CID 176881039 (PubChem CID 176881039) has the molecular formula C43H30F2IrN2-2
and a molecular weight of 804.94 g/mol.
Molecular Properties
| Compound Name | CID 176881039 |
| PubChem CID | 176881039 |
| Molecular Formula | C43H30F2IrN2-2 |
| Molecular Weight | 804.94 g/mol |
| Exact Mass | 805.20 |
| IUPAC Name | — |
| SMILES | CC(C)Cc1ccc2ccc3c4ccnc5c4c(cc3c2c1)C(F)(F)c1cc2ccccc2[c-]c1-5.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C32H22F2N.C11H8N.Ir/c1-18(2)13-19-7-8-20-9-10-23-24-11-12-35-31-27-15-21-5-3-4-6-22(21)16-28(27)32(33,34)29(30(24)31)17-26(23)25(20)14-19;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-12,14,16-18H,13H2,1-2H3;1-6,8-9H;/q2*-1; |
| InChIKey | YNCJRBYMRYJJQX-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 804.94 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176881039 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176881039?
The IUPAC name of CID 176881039 (CID 176881039) is not available.
What is the SMILES notation for CID 176881039?
The canonical SMILES for CID 176881039 is CC(C)Cc1ccc2ccc3c4ccnc5c4c(cc3c2c1)C(F)(F)c1cc2ccccc2[c-]c1-5.[Ir].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of CID 176881039?
The InChIKey is YNCJRBYMRYJJQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H22F2N.C11H8N.Ir/c1-18(2)13-19-7-8-20-9-10-23-24-11-12-35-31-27-15-21-5-3-4-6-22(21)16-28(27)32(33,34)29(30(24)31)17-26(23)25(20)14-19;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-12,14,16-18H,13H2,1-2H3;1-6,8-9H;/q2*-1;.
What are the key properties of CID 176881039?
CID 176881039 has a molecular weight of 804.94 g/mol, XLogP of 11.36, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176881039 is sourced from PubChem (CID 176881039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).