About CID 176881067
CID 176881067 (PubChem CID 176881067) has the molecular formula C45H51IrN2O2Si-
and a molecular weight of 872.22 g/mol.
Molecular Properties
| Compound Name | CID 176881067 |
| PubChem CID | 176881067 |
| Molecular Formula | C45H51IrN2O2Si- |
| Molecular Weight | 872.22 g/mol |
| Exact Mass | 872.34 |
| IUPAC Name | — |
| SMILES | CC(C)Cc1ccc2ccc3c4ccnc5c4c(cc3c2c1)[Si](C)(C)c1nc2ccccc2[c-]c1-5.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C32H27N2Si.C13H24O2.Ir/c1-19(2)15-20-9-10-21-11-12-23-24-13-14-33-31-27-17-22-7-5-6-8-28(22)34-32(27)35(3,4)29(30(24)31)18-26(23)25(21)16-20;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-14,16,18-19H,15H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | GWTCSWNFQTZHRD-DZTQYQPZSA-N |
| XLogP | 10.76 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 872.22 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176881067 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176881067?
The IUPAC name of CID 176881067 (CID 176881067) is not available.
What is the SMILES notation for CID 176881067?
The canonical SMILES for CID 176881067 is CC(C)Cc1ccc2ccc3c4ccnc5c4c(cc3c2c1)[Si](C)(C)c1nc2ccccc2[c-]c1-5.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].
What is the InChIKey of CID 176881067?
The InChIKey is GWTCSWNFQTZHRD-DZTQYQPZSA-N. The full InChI is InChI=1S/C32H27N2Si.C13H24O2.Ir/c1-19(2)15-20-9-10-21-11-12-23-24-13-14-33-31-27-17-22-7-5-6-8-28(22)34-32(27)35(3,4)29(30(24)31)18-26(23)25(21)16-20;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-14,16,18-19H,15H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;.
What are the key properties of CID 176881067?
CID 176881067 has a molecular weight of 872.22 g/mol, XLogP of 10.76, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176881067 is sourced from PubChem (CID 176881067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).