About CID 164749210
CID 164749210 (PubChem CID 164749210) has the molecular formula C39H49IrN2O2-
and a molecular weight of 772.06 g/mol.
Molecular Properties
| Compound Name | CID 164749210 |
| PubChem CID | 164749210 |
| Molecular Formula | C39H49IrN2O2- |
| Molecular Weight | 772.06 g/mol |
| Exact Mass | 772.36 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[2H]C([2H])(c1cc2c3c(nccc3c1)-c1[c-]c3ccccc3nc1C2(C)C)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C26H25N2.C13H24O2.Ir/c1-25(2,3)15-16-12-18-10-11-27-23-19-14-17-8-6-7-9-21(17)28-24(19)26(4,5)20(13-16)22(18)23;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-13H,15H2,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;/i15D2;; |
| InChIKey | XHDWTKLVTHTEIS-YAZJDUKMSA-N |
| XLogP | 10.35 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 772.06 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164749210 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164749210?
The IUPAC name of CID 164749210 (CID 164749210) is not available.
What is the SMILES notation for CID 164749210?
The canonical SMILES for CID 164749210 is CCC(CC)C(=O)/C=C(\O)C(CC)CC.[2H]C([2H])(c1cc2c3c(nccc3c1)-c1[c-]c3ccccc3nc1C2(C)C)C(C)(C)C.[Ir].
What is the InChIKey of CID 164749210?
The InChIKey is XHDWTKLVTHTEIS-YAZJDUKMSA-N. The full InChI is InChI=1S/C26H25N2.C13H24O2.Ir/c1-25(2,3)15-16-12-18-10-11-27-23-19-14-17-8-6-7-9-21(17)28-24(19)26(4,5)20(13-16)22(18)23;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-13H,15H2,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;/i15D2;;.
What are the key properties of CID 164749210?
CID 164749210 has a molecular weight of 772.06 g/mol, XLogP of 10.35, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164749210 is sourced from PubChem (CID 164749210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).