About CID 164749066
CID 164749066 (PubChem CID 164749066) has the molecular formula C40H49IrN2O2-
and a molecular weight of 782.06 g/mol.
Molecular Properties
| Compound Name | CID 164749066 |
| PubChem CID | 164749066 |
| Molecular Formula | C40H49IrN2O2- |
| Molecular Weight | 782.06 g/mol |
| Exact Mass | 782.34 |
| IUPAC Name | — |
| SMILES | CC1(C)c2nc3ccccc3[c-]c2-c2nccc3cc(C4CCCCC4)cc1c23.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C27H25N2.C13H24O2.Ir/c1-27(2)22-16-20(17-8-4-3-5-9-17)14-19-12-13-28-25(24(19)22)21-15-18-10-6-7-11-23(18)29-26(21)27;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-7,10-14,16-17H,3-5,8-9H2,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | WQULCNDRGLGOIY-DZTQYQPZSA-N |
| XLogP | 10.80 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 782.06 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164749066 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164749066?
The IUPAC name of CID 164749066 (CID 164749066) is not available.
What is the SMILES notation for CID 164749066?
The canonical SMILES for CID 164749066 is CC1(C)c2nc3ccccc3[c-]c2-c2nccc3cc(C4CCCCC4)cc1c23.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].
What is the InChIKey of CID 164749066?
The InChIKey is WQULCNDRGLGOIY-DZTQYQPZSA-N. The full InChI is InChI=1S/C27H25N2.C13H24O2.Ir/c1-27(2)22-16-20(17-8-4-3-5-9-17)14-19-12-13-28-25(24(19)22)21-15-18-10-6-7-11-23(18)29-26(21)27;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-7,10-14,16-17H,3-5,8-9H2,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;.
What are the key properties of CID 164749066?
CID 164749066 has a molecular weight of 782.06 g/mol, XLogP of 10.80, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164749066 is sourced from PubChem (CID 164749066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).