C52H64IrNO3- — CID 177102551
CID 177102551 (PubChem CID 177102551) has the molecular formula C52H64IrNO3- and a molecular weight of 943.30 g/mol.
| Compound Name | CID 177102551 |
|---|---|
| PubChem CID | 177102551 |
| Molecular Formula | C52H64IrNO3- |
| Molecular Weight | 943.30 g/mol |
| Exact Mass | 943.45 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc2c(cc1-c1cc3c4c(nccc4c1)-c1[c-]c4ccccc4c(C(C)(C)C)c1O3)C(C)(C)CCCC2(C)C.[Ir] |
| InChI | InChI=1S/C39H40NO.C13H24O2.Ir/c1-23-18-30-31(39(7,8)16-11-15-38(30,5)6)22-28(23)26-19-25-14-17-40-35-29-20-24-12-9-10-13-27(24)34(37(2,3)4)36(29)41-32(21-26)33(25)35;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h9-10,12-14,17-19,21-22H,11,15-16H2,1-8H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | FVBLHLXVNKYWPE-DZTQYQPZSA-N |
| XLogP | 14.84 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.30 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|