C41H54GeIrNO3- — CID 176607128
CID 176607128 (PubChem CID 176607128) has the molecular formula C41H54GeIrNO3- and a molecular weight of 873.71 g/mol.
| Compound Name | CID 176607128 |
|---|---|
| PubChem CID | 176607128 |
| Molecular Formula | C41H54GeIrNO3- |
| Molecular Weight | 873.71 g/mol |
| Exact Mass | 875.30 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc([Ge](C)(C)C)c2ccnc3c2c1Oc1c-3[c-]c2ccccc2c1CC(C)(C)C.[Ir] |
| InChI | InChI=1S/C28H30GeNO.C13H24O2.Ir/c1-17-14-23(29(5,6)7)20-12-13-30-25-21-15-18-10-8-9-11-19(18)22(16-28(2,3)4)27(21)31-26(17)24(20)25;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h8-14H,16H2,1-7H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | OHVNLYFOMNFJEC-DZTQYQPZSA-N |
| XLogP | 11.27 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.71 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|