C45H48IrNO3S- — CID 171423638
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;7-(2,2-dimethylpropyl)-1-(5H-naphtho[2,1-b][1]benzofuran-5-id-6-yl)-[1]benzothiolo[2,3-c]pyridine;iridium (PubChem CID 171423638) has the molecular formula C45H48IrNO3S- and a molecular weight of 875.17 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;7-(2,2-dimethylpropyl)-1-(5H-naphtho[2,1-b][1]benzofuran-5-id-6-yl)-[1]benzothiolo[2,3-c]pyridine;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;7-(2,2-dimethylpropyl)-1-(5H-naphtho[2,1-b][1]benzofuran-5-id-6-yl)-[1]benzothiolo[2,3-c]pyridine;iridium |
|---|---|
| PubChem CID | 171423638 |
| Molecular Formula | C45H48IrNO3S- |
| Molecular Weight | 875.17 g/mol |
| Exact Mass | 875.30 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;7-(2,2-dimethylpropyl)-1-(5H-naphtho[2,1-b][1]benzofuran-5-id-6-yl)-[1]benzothiolo[2,3-c]pyridine;iridium |
| SMILES | CC(C)(C)Cc1ccc2c(c1)sc1c(-c3[c-]c4ccccc4c4c3oc3ccccc34)nccc12.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C32H24NOS.C13H24O2.Ir/c1-32(2,3)18-19-12-13-22-23-14-15-33-29(31(23)35-27(22)16-19)25-17-20-8-4-5-9-21(20)28-24-10-6-7-11-26(24)34-30(25)28;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-16H,18H2,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | CBRNCIVKVPJKBQ-DZTQYQPZSA-N |
| XLogP | 13.43 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.17 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|