C44H44IrNO4- — CID 165168192
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;5-methyl-4-(3-methyl-1-benzofuran-2-yl)-2-(5H-naphtho[2,1-b][1]benzofuran-5-id-6-yl)pyridine (PubChem CID 165168192) has the molecular formula C44H44IrNO4- and a molecular weight of 843.06 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;5-methyl-4-(3-methyl-1-benzofuran-2-yl)-2-(5H-naphtho[2,1-b][1]benzofuran-5-id-6-yl)pyridine.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;5-methyl-4-(3-methyl-1-benzofuran-2-yl)-2-(5H-naphtho[2,1-b][1]benzofuran-5-id-6-yl)pyridine |
|---|---|
| PubChem CID | 165168192 |
| Molecular Formula | C44H44IrNO4- |
| Molecular Weight | 843.06 g/mol |
| Exact Mass | 843.29 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;5-methyl-4-(3-methyl-1-benzofuran-2-yl)-2-(5H-naphtho[2,1-b][1]benzofuran-5-id-6-yl)pyridine |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cnc(-c2[c-]c3ccccc3c3c2oc2ccccc23)cc1-c1oc2ccccc2c1C.[Ir] |
| InChI | InChI=1S/C31H20NO2.C13H24O2.Ir/c1-18-17-32-26(16-24(18)30-19(2)21-10-5-7-13-27(21)33-30)25-15-20-9-3-4-11-22(20)29-23-12-6-8-14-28(23)34-31(25)29;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-14,16-17H,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | LMIKNKGJJVLVBT-DZTQYQPZSA-N |
| XLogP | 12.50 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.06 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|