C36H36IrNO3S- — CID 176584116
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;2-(5H-naphtho[1,2-b][1]benzothiol-5-id-6-yl)-1,3-benzoxazole (PubChem CID 176584116) has the molecular formula C36H36IrNO3S- and a molecular weight of 754.97 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;2-(5H-naphtho[1,2-b][1]benzothiol-5-id-6-yl)-1,3-benzoxazole.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;2-(5H-naphtho[1,2-b][1]benzothiol-5-id-6-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 176584116 |
| Molecular Formula | C36H36IrNO3S- |
| Molecular Weight | 754.97 g/mol |
| Exact Mass | 755.21 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;2-(5H-naphtho[1,2-b][1]benzothiol-5-id-6-yl)-1,3-benzoxazole |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].[c-]1c(-c2nc3ccccc3o2)c2c3ccccc3sc2c2ccccc12 |
| InChI | InChI=1S/C23H12NOS.C13H24O2.Ir/c1-2-8-15-14(7-1)13-17(23-24-18-10-4-5-11-19(18)25-23)21-16-9-3-6-12-20(16)26-22(15)21;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-12H;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | RDDCYMLSKACTFN-DZTQYQPZSA-N |
| XLogP | 10.68 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.97 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|