C47H54IrNO3- — CID 168852938
1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-(2,4,6-trimethylphenyl)-[1]benzofuro[2,3-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 168852938) has the molecular formula C47H54IrNO3- and a molecular weight of 873.17 g/mol. Its IUPAC name is 1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-(2,4,6-trimethylphenyl)-[1]benzofuro[2,3-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-(2,4,6-trimethylphenyl)-[1]benzofuro[2,3-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 168852938 |
| Molecular Formula | C47H54IrNO3- |
| Molecular Weight | 873.17 g/mol |
| Exact Mass | 873.37 |
| IUPAC Name | 1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-(2,4,6-trimethylphenyl)-[1]benzofuro[2,3-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc(C)c(-c2ccc3c(c2)oc2c(-c4[c-]c5ccccc5c(C(C)(C)C)c4)nccc23)c(C)c1.[Ir] |
| InChI | InChI=1S/C34H30NO.C13H24O2.Ir/c1-20-15-21(2)31(22(3)16-20)24-11-12-27-28-13-14-35-32(33(28)36-30(27)19-24)25-17-23-9-7-8-10-26(23)29(18-25)34(4,5)6;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h7-16,18-19H,1-6H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | QMBJFSWMMZOIIS-DZTQYQPZSA-N |
| XLogP | 13.36 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.17 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|