C43H57BIrN3O2- — CID 166020500
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-1,3-dimethyl-2-(2,4,6-trimethylphenyl)-[1,3,2]diazaborolo[4,5-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 166020500) has the molecular formula C43H57BIrN3O2- and a molecular weight of 850.98 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-1,3-dimethyl-2-(2,4,6-trimethylphenyl)-[1,3,2]diazaborolo[4,5-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-1,3-dimethyl-2-(2,4,6-trimethylphenyl)-[1,3,2]diazaborolo[4,5-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 166020500 |
| Molecular Formula | C43H57BIrN3O2- |
| Molecular Weight | 850.98 g/mol |
| Exact Mass | 851.42 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-1,3-dimethyl-2-(2,4,6-trimethylphenyl)-[1,3,2]diazaborolo[4,5-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc(C)c(B2N(C)c3ccnc(-c4[c-]c5ccccc5c(C(C)(C)C)c4)c3N2C)c(C)c1.[Ir] |
| InChI | InChI=1S/C30H33BN3.C13H24O2.Ir/c1-19-15-20(2)27(21(3)16-19)31-33(7)26-13-14-32-28(29(26)34(31)8)23-17-22-11-9-10-12-24(22)25(18-23)30(4,5)6;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h9-16,18H,1-8H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | VEWFBULSHNSXDP-DZTQYQPZSA-N |
| XLogP | 10.07 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.98 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|