C45H60IrNO2SeSi- — CID 167427608
[1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-methyl-[1]benzoselenolo[2,3-c]pyridin-7-yl]-triethylsilane;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 167427608) has the molecular formula C45H60IrNO2SeSi- and a molecular weight of 946.24 g/mol. Its IUPAC name is [1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-methyl-[1]benzoselenolo[2,3-c]pyridin-7-yl]-triethylsilane;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | [1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-methyl-[1]benzoselenolo[2,3-c]pyridin-7-yl]-triethylsilane;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 167427608 |
| Molecular Formula | C45H60IrNO2SeSi- |
| Molecular Weight | 946.24 g/mol |
| Exact Mass | 947.32 |
| IUPAC Name | [1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-methyl-[1]benzoselenolo[2,3-c]pyridin-7-yl]-triethylsilane;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.CC[Si](CC)(CC)c1ccc2c([se]c3c(-c4[c-]c5ccccc5c(C(C)(C)C)c4)nccc32)c1C.[Ir] |
| InChI | InChI=1S/C32H36NSeSi.C13H24O2.Ir/c1-8-35(9-2,10-3)28-16-15-25-26-17-18-33-29(31(26)34-30(25)21(28)4)23-19-22-13-11-12-14-24(22)27(20-23)32(5,6)7;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h11-18,20H,8-10H2,1-7H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | YOVSVUPMIPYJAY-DZTQYQPZSA-N |
| XLogP | 12.25 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.24 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|