C46H58IrNO2Se- — CID 167427506
1-(4-cyclohexyl-1H-naphthalen-1-id-2-yl)-7-(2,2-dimethylpropyl)-8-methyl-[1]benzoselenolo[2,3-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 167427506) has the molecular formula C46H58IrNO2Se- and a molecular weight of 928.15 g/mol. Its IUPAC name is 1-(4-cyclohexyl-1H-naphthalen-1-id-2-yl)-7-(2,2-dimethylpropyl)-8-methyl-[1]benzoselenolo[2,3-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 1-(4-cyclohexyl-1H-naphthalen-1-id-2-yl)-7-(2,2-dimethylpropyl)-8-methyl-[1]benzoselenolo[2,3-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 167427506 |
| Molecular Formula | C46H58IrNO2Se- |
| Molecular Weight | 928.15 g/mol |
| Exact Mass | 929.33 |
| IUPAC Name | 1-(4-cyclohexyl-1H-naphthalen-1-id-2-yl)-7-(2,2-dimethylpropyl)-8-methyl-[1]benzoselenolo[2,3-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1c(CC(C)(C)C)ccc2c1[se]c1c(-c3[c-]c4ccccc4c(C4CCCCC4)c3)nccc12.[Ir] |
| InChI | InChI=1S/C33H34NSe.C13H24O2.Ir/c1-21-24(20-33(2,3)4)14-15-27-28-16-17-34-30(32(28)35-31(21)27)25-18-23-12-8-9-13-26(23)29(19-25)22-10-6-5-7-11-22;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h8-9,12-17,19,22H,5-7,10-11,20H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | KMPDAMFCNQMXGF-DZTQYQPZSA-N |
| XLogP | 12.88 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.15 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|