C39H46IrNO3- — CID 170517259
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-1-methyl-3H-[1]benzofuro[3,2-b]pyridin-1-ium-3-ide;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 170517259) has the molecular formula C39H46IrNO3- and a molecular weight of 769.02 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-1-methyl-3H-[1]benzofuro[3,2-b]pyridin-1-ium-3-ide;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-1-methyl-3H-[1]benzofuro[3,2-b]pyridin-1-ium-3-ide;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 170517259 |
| Molecular Formula | C39H46IrNO3- |
| Molecular Weight | 769.02 g/mol |
| Exact Mass | 769.31 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-1-methyl-3H-[1]benzofuro[3,2-b]pyridin-1-ium-3-ide;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.C[n+]1c[c-]c(-c2[c-]c3ccccc3c(C(C)(C)C)c2)c2oc3ccccc3c21.[Ir] |
| InChI | InChI=1S/C26H22NO.C13H24O2.Ir/c1-26(2,3)22-16-18(15-17-9-5-6-10-19(17)22)20-13-14-27(4)24-21-11-7-8-12-23(21)28-25(20)24;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-12,14,16H,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | CTQJAQUTZZDMEX-DZTQYQPZSA-N |
| XLogP | 10.00 |
| TPSA | 54.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.02 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|