C39H47IrN2O4- — CID 169043970
5-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-2-(3,5-dimethylphenyl)-[1,3]oxazolo[5,4-d][1,3]oxazole;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 169043970) has the molecular formula C39H47IrN2O4- and a molecular weight of 800.03 g/mol. Its IUPAC name is 5-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-2-(3,5-dimethylphenyl)-[1,3]oxazolo[5,4-d][1,3]oxazole;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 5-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-2-(3,5-dimethylphenyl)-[1,3]oxazolo[5,4-d][1,3]oxazole;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 169043970 |
| Molecular Formula | C39H47IrN2O4- |
| Molecular Weight | 800.03 g/mol |
| Exact Mass | 800.32 |
| IUPAC Name | 5-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-2-(3,5-dimethylphenyl)-[1,3]oxazolo[5,4-d][1,3]oxazole;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc(C)cc(-c2nc3oc(-c4[c-]c5ccccc5c(C(C)(C)C)c4)nc3o2)c1.[Ir] |
| InChI | InChI=1S/C26H23N2O2.C13H24O2.Ir/c1-15-10-16(2)12-18(11-15)22-27-24-25(29-22)28-23(30-24)19-13-17-8-6-7-9-20(17)21(14-19)26(3,4)5;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-12,14H,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | GCAGTBHYHXTGHN-DZTQYQPZSA-N |
| XLogP | 10.88 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.03 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|