C35H42IrNO3- — CID 155626200
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;5-(3,5-dimethylbenzene-6-id-1-yl)-3-methyl-2-phenylfuro[2,3-c]pyridine;iridium (PubChem CID 155626200) has the molecular formula C35H42IrNO3- and a molecular weight of 716.94 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;5-(3,5-dimethylbenzene-6-id-1-yl)-3-methyl-2-phenylfuro[2,3-c]pyridine;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;5-(3,5-dimethylbenzene-6-id-1-yl)-3-methyl-2-phenylfuro[2,3-c]pyridine;iridium |
|---|---|
| PubChem CID | 155626200 |
| Molecular Formula | C35H42IrNO3- |
| Molecular Weight | 716.94 g/mol |
| Exact Mass | 717.28 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;5-(3,5-dimethylbenzene-6-id-1-yl)-3-methyl-2-phenylfuro[2,3-c]pyridine;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2cc3c(C)c(-c4ccccc4)oc3cn2)cc(C)c1.[Ir] |
| InChI | InChI=1S/C22H18NO.C13H24O2.Ir/c1-14-9-15(2)11-18(10-14)20-12-19-16(3)22(24-21(19)13-23-20)17-7-5-4-6-8-17;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-10,12-13H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | IFRUDLXPHGPMKG-DZTQYQPZSA-N |
| XLogP | 9.75 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.94 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|