C38H50NO2Pt- — CID 170539608
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;2-(3,5-dimethylbenzene-6-id-1-yl)-5-(4-phenylcyclohexyl)pyridine;platinum (PubChem CID 170539608) has the molecular formula C38H50NO2Pt- and a molecular weight of 747.90 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;2-(3,5-dimethylbenzene-6-id-1-yl)-5-(4-phenylcyclohexyl)pyridine;platinum.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;2-(3,5-dimethylbenzene-6-id-1-yl)-5-(4-phenylcyclohexyl)pyridine;platinum |
|---|---|
| PubChem CID | 170539608 |
| Molecular Formula | C38H50NO2Pt- |
| Molecular Weight | 747.90 g/mol |
| Exact Mass | 747.35 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;2-(3,5-dimethylbenzene-6-id-1-yl)-5-(4-phenylcyclohexyl)pyridine;platinum |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2ccc(C3CCC(c4ccccc4)CC3)cn2)cc(C)c1.[Pt] |
| InChI | InChI=1S/C25H26N.C13H24O2.Pt/c1-18-14-19(2)16-24(15-18)25-13-12-23(17-26-25)22-10-8-21(9-11-22)20-6-4-3-5-7-20;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-7,12-15,17,21-22H,8-11H2,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | VLLWHSKGVPWLPN-DZTQYQPZSA-N |
| XLogP | 10.47 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.90 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|