C44H41FIrO4-2 — CID 171423694
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;9-fluoro-6-[3-(3-methyl-1-benzofuran-2-yl)benzene-6-id-1-yl]-5H-naphtho[2,1-b][1]benzofuran-5-ide;iridium (PubChem CID 171423694) has the molecular formula C44H41FIrO4-2 and a molecular weight of 845.02 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;9-fluoro-6-[3-(3-methyl-1-benzofuran-2-yl)benzene-6-id-1-yl]-5H-naphtho[2,1-b][1]benzofuran-5-ide;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;9-fluoro-6-[3-(3-methyl-1-benzofuran-2-yl)benzene-6-id-1-yl]-5H-naphtho[2,1-b][1]benzofuran-5-ide;iridium |
|---|---|
| PubChem CID | 171423694 |
| Molecular Formula | C44H41FIrO4-2 |
| Molecular Weight | 845.02 g/mol |
| Exact Mass | 845.26 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;9-fluoro-6-[3-(3-methyl-1-benzofuran-2-yl)benzene-6-id-1-yl]-5H-naphtho[2,1-b][1]benzofuran-5-ide;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1c(-c2cc[c-]c(-c3[c-]c4ccccc4c4c3oc3cc(F)ccc34)c2)oc2ccccc12.[Ir] |
| InChI | InChI=1S/C31H17FO2.C13H24O2.Ir/c1-18-23-10-4-5-12-27(23)33-30(18)21-9-6-8-19(15-21)26-16-20-7-2-3-11-24(20)29-25-14-13-22(32)17-28(25)34-31(26)29;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h2-7,9-15,17H,1H3;9-11,14H,5-8H2,1-4H3;/q-2;;/b;12-9-; |
| InChIKey | RRRKBKZGRQSKIN-DZTQYQPZSA-N |
| XLogP | 12.73 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.02 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|