C49H56IrNO2- — CID 177109262
CID 177109262 (PubChem CID 177109262) has the molecular formula C49H56IrNO2- and a molecular weight of 883.21 g/mol.
| Compound Name | CID 177109262 |
|---|---|
| PubChem CID | 177109262 |
| Molecular Formula | C49H56IrNO2- |
| Molecular Weight | 883.21 g/mol |
| Exact Mass | 883.39 |
| IUPAC Name | — |
| SMILES | CC(C)(C)Cc1c2ccccc2[c-]c2c3nccc4c5ccc(C(C)(C)C)cc5c5cccc(c12)c5c43.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C36H32N.C13H24O2.Ir/c1-35(2,3)20-30-23-11-8-7-10-21(23)18-29-31(30)27-13-9-12-25-28-19-22(36(4,5)6)14-15-24(28)26-16-17-37-34(29)33(26)32(25)27;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h7-17,19H,20H2,1-6H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | CNTCCPPITIKLND-DZTQYQPZSA-N |
| XLogP | 13.99 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.21 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|