C40H46IrN3O2- — CID 177286223
CID 177286223 (PubChem CID 177286223) has the molecular formula C40H46IrN3O2- and a molecular weight of 793.04 g/mol.
| Compound Name | CID 177286223 |
|---|---|
| PubChem CID | 177286223 |
| Molecular Formula | C40H46IrN3O2- |
| Molecular Weight | 793.04 g/mol |
| Exact Mass | 793.32 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1ccc2[c-]c3c(cc2n1)c1cccc2c(CC(C)(C)C)cc4ncnc3c4c21.[Ir] |
| InChI | InChI=1S/C27H22N3.C13H24O2.Ir/c1-15-8-9-16-10-21-20(12-22(16)30-15)19-7-5-6-18-17(13-27(2,3)4)11-23-25(24(18)19)26(21)29-14-28-23;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-9,11-12,14H,13H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | BQFGTJYFZLKVBE-DZTQYQPZSA-N |
| XLogP | 10.64 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.04 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|