C37H43IrN2O2SSi- — CID 177109378
CID 177109378 (PubChem CID 177109378) has the molecular formula C37H43IrN2O2SSi- and a molecular weight of 800.13 g/mol.
| Compound Name | CID 177109378 |
|---|---|
| PubChem CID | 177109378 |
| Molecular Formula | C37H43IrN2O2SSi- |
| Molecular Weight | 800.13 g/mol |
| Exact Mass | 800.24 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1sc2c([Si](C)(C)C)cc3ncnc4c5[c-]c6ccccc6cc5c1c2c34.[Ir] |
| InChI | InChI=1S/C24H19N2SSi.C13H24O2.Ir/c1-13-20-16-9-14-7-5-6-8-15(14)10-17(16)23-21-18(25-12-26-23)11-19(28(2,3)4)24(27-13)22(20)21;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-9,11-12H,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | KHNLRIDLTUHJDO-DZTQYQPZSA-N |
| XLogP | 10.26 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.13 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|