C47H54IrN3O2- — CID 177286113
CID 177286113 (PubChem CID 177286113) has the molecular formula C47H54IrN3O2- and a molecular weight of 885.18 g/mol.
| Compound Name | CID 177286113 |
|---|---|
| PubChem CID | 177286113 |
| Molecular Formula | C47H54IrN3O2- |
| Molecular Weight | 885.18 g/mol |
| Exact Mass | 885.39 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1ccc2[c-]c3c(cc2n1)c1cc(C(C)(C)C)cc2c4cc(C(C)(C)C)ccc4c4ncnc3c4c12.[Ir] |
| InChI | InChI=1S/C34H30N3.C13H24O2.Ir/c1-18-8-9-19-12-27-24(16-28(19)37-18)26-15-21(34(5,6)7)14-25-23-13-20(33(2,3)4)10-11-22(23)31-30(29(25)26)32(27)36-17-35-31;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h8-11,13-17H,1-7H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | DSRROHVVNPRINF-DZTQYQPZSA-N |
| XLogP | 12.80 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.18 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|