C44H48IrNO2S- — CID 177109294
CID 177109294 (PubChem CID 177109294) has the molecular formula C44H48IrNO2S- and a molecular weight of 847.16 g/mol.
| Compound Name | CID 177109294 |
|---|---|
| PubChem CID | 177109294 |
| Molecular Formula | C44H48IrNO2S- |
| Molecular Weight | 847.16 g/mol |
| Exact Mass | 847.30 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1c(CC(C)(C)C)c2cccc3c4cc5c([c-]c4c4nccc1c4c23)sc1ccccc15.[Ir] |
| InChI | InChI=1S/C31H24NS.C13H24O2.Ir/c1-17-18-12-13-32-30-24-15-27-23(19-8-5-6-11-26(19)33-27)14-22(24)20-9-7-10-21(28(20)29(18)30)25(17)16-31(2,3)4;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-14H,16H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | BJCQXNBVLPDJOF-DZTQYQPZSA-N |
| XLogP | 13.06 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.16 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|