C42H50IrNO3- — CID 176812452
CID 176812452 (PubChem CID 176812452) has the molecular formula C42H50IrNO3- and a molecular weight of 809.08 g/mol.
| Compound Name | CID 176812452 |
|---|---|
| PubChem CID | 176812452 |
| Molecular Formula | C42H50IrNO3- |
| Molecular Weight | 809.08 g/mol |
| Exact Mass | 809.34 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1c2c([c-]c3ccccc13)-c1nccc3cc4c(c(c13)O2)C(C)(C)CC41CCCC1.[Ir] |
| InChI | InChI=1S/C29H26NO.C13H24O2.Ir/c1-17-20-9-5-4-8-18(20)14-21-25-23-19(10-13-30-25)15-22-24(27(23)31-26(17)21)28(2,3)16-29(22)11-6-7-12-29;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-5,8-10,13,15H,6-7,11-12,16H2,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | LLGHUFQZNMHVKV-DZTQYQPZSA-N |
| XLogP | 11.63 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.08 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|