C43H52IrNO3- — CID 176812549
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;6,6,9,9-tetramethyl-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)-7,8-dihydrobenzo[g]isoquinoline (PubChem CID 176812549) has the molecular formula C43H52IrNO3- and a molecular weight of 823.11 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;6,6,9,9-tetramethyl-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)-7,8-dihydrobenzo[g]isoquinoline.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;6,6,9,9-tetramethyl-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)-7,8-dihydrobenzo[g]isoquinoline |
|---|---|
| PubChem CID | 176812549 |
| Molecular Formula | C43H52IrNO3- |
| Molecular Weight | 823.11 g/mol |
| Exact Mass | 823.36 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;6,6,9,9-tetramethyl-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)-7,8-dihydrobenzo[g]isoquinoline |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2nccc3cc4c(cc23)C(C)(C)CCC4(C)C)c2oc3ccccc3c2c1.[Ir] |
| InChI | InChI=1S/C30H28NO.C13H24O2.Ir/c1-18-14-22-20-8-6-7-9-26(20)32-28(22)23(15-18)27-21-17-25-24(16-19(21)10-13-31-27)29(2,3)11-12-30(25,4)5;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-10,13-14,16-17H,11-12H2,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | JZWIEOLJOSCRRN-DZTQYQPZSA-N |
| XLogP | 12.13 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.11 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|