C43H52IrN3O2- — CID 176812349
CID 176812349 (PubChem CID 176812349) has the molecular formula C43H52IrN3O2- and a molecular weight of 835.12 g/mol.
| Compound Name | CID 176812349 |
|---|---|
| PubChem CID | 176812349 |
| Molecular Formula | C43H52IrN3O2- |
| Molecular Weight | 835.12 g/mol |
| Exact Mass | 835.37 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c2c3nccc4cc5c(c(c43)n3c4nc(C)ccc4c(c1)c23)C(C)(C)CCC5(C)C.[Ir] |
| InChI | InChI=1S/C30H28N3.C13H24O2.Ir/c1-16-13-20-19-8-7-17(2)32-28(19)33-26(20)21(14-16)25-23-18(9-12-31-25)15-22-24(27(23)33)30(5,6)11-10-29(22,3)4;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h7-9,12-13,15H,10-11H2,1-6H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | CPKDOLCEDCDUHC-DZTQYQPZSA-N |
| XLogP | 11.41 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.12 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|