C43H53IrN2O2Si- — CID 176802784
CID 176802784 (PubChem CID 176802784) has the molecular formula C43H53IrN2O2Si- and a molecular weight of 850.21 g/mol.
| Compound Name | CID 176802784 |
|---|---|
| PubChem CID | 176802784 |
| Molecular Formula | C43H53IrN2O2Si- |
| Molecular Weight | 850.21 g/mol |
| Exact Mass | 850.35 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(C)(CC)CC.Cc1[c-]c2c3nccc4cc(C5CC[Si](C)(C)CC5)cc(c43)n3c4ccccc4c(c1)c23.[Ir] |
| InChI | InChI=1S/C29H27N2Si.C14H26O2.Ir/c1-18-14-23-22-6-4-5-7-25(22)31-26-17-21(19-9-12-32(2,3)13-10-19)16-20-8-11-30-28(27(20)26)24(15-18)29(23)31;1-6-11(7-2)12(15)10-13(16)14(5,8-3)9-4;/h4-8,11,14,16-17,19H,9-10,12-13H2,1-3H3;10-11,16H,6-9H2,1-5H3;/q-1;;/b;13-10-; |
| InChIKey | QCWZVWNHECWVGU-BEGQHWPVSA-N |
| XLogP | 12.34 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.21 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|