C40H39IrN2O2- — CID 168733855
CID 168733855 (PubChem CID 168733855) has the molecular formula C40H39IrN2O2- and a molecular weight of 771.98 g/mol.
| Compound Name | CID 168733855 |
|---|---|
| PubChem CID | 168733855 |
| Molecular Formula | C40H39IrN2O2- |
| Molecular Weight | 771.98 g/mol |
| Exact Mass | 772.26 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].[c-]1c(-c2cc3ccccc3cn2)c2c3ccccc3cc3c4ccccc4n1c32 |
| InChI | InChI=1S/C27H15N2.C13H24O2.Ir/c1-2-9-19-15-28-24(14-17(19)7-1)23-16-29-25-12-6-5-11-21(25)22-13-18-8-3-4-10-20(18)26(23)27(22)29;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-15H;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | CQAJQQSYBRGLPE-DZTQYQPZSA-N |
| XLogP | 10.72 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.98 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|