C36H43IrN2O2Se- — CID 166570532
1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)imidazo[5,1-b][1,3]benzoselenazole;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 166570532) has the molecular formula C36H43IrN2O2Se- and a molecular weight of 806.93 g/mol. Its IUPAC name is 1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)imidazo[5,1-b][1,3]benzoselenazole;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)imidazo[5,1-b][1,3]benzoselenazole;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 166570532 |
| Molecular Formula | C36H43IrN2O2Se- |
| Molecular Weight | 806.93 g/mol |
| Exact Mass | 808.21 |
| IUPAC Name | 1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)imidazo[5,1-b][1,3]benzoselenazole;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CC(C)(C)c1cc(-c2ncc3[se]c4ccccc4n23)[c-]c2ccccc12.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C23H19N2Se.C13H24O2.Ir/c1-23(2,3)18-13-16(12-15-8-4-5-9-17(15)18)22-24-14-21-25(22)19-10-6-7-11-20(19)26-21;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-11,13-14H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | QDAPTOOGQJGQBS-DZTQYQPZSA-N |
| XLogP | 9.33 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.93 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|