C43H51IrN2O2- — CID 176812436
CID 176812436 (PubChem CID 176812436) has the molecular formula C43H51IrN2O2- and a molecular weight of 822.12 g/mol.
| Compound Name | CID 176812436 |
|---|---|
| PubChem CID | 176812436 |
| Molecular Formula | C43H51IrN2O2- |
| Molecular Weight | 822.12 g/mol |
| Exact Mass | 822.37 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[2H]c1nc2c3[c-]c(C)cc4c5ccccc5n(c5c6c(cc(c1[2H])c25)C(C)(C)CCC6(C)C)c34.[Ir] |
| InChI | InChI=1S/C30H27N2.C13H24O2.Ir/c1-17-14-20-19-8-6-7-9-23(19)32-27(20)21(15-17)26-24-18(10-13-31-26)16-22-25(28(24)32)30(4,5)12-11-29(22,2)3;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-10,13-14,16H,11-12H2,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;/i10D,13D;; |
| InChIKey | UFZCFSHMSZAVMM-GQBHIOPISA-N |
| XLogP | 11.71 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.12 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|