C40H49IrN2O2Si- — CID 167365877
CID 167365877 (PubChem CID 167365877) has the molecular formula C40H49IrN2O2Si- and a molecular weight of 811.15 g/mol.
| Compound Name | CID 167365877 |
|---|---|
| PubChem CID | 167365877 |
| Molecular Formula | C40H49IrN2O2Si- |
| Molecular Weight | 811.15 g/mol |
| Exact Mass | 811.33 |
| IUPAC Name | — |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.[2H]c1cc2cc([Si](C)(C)C)cc3c2c(n1)c1[c-]c(C)cc2c4ccccc4n3c12.[Ir] |
| InChI | InChI=1S/C25H21N2Si.C15H28O2.Ir/c1-15-11-19-18-7-5-6-8-21(18)27-22-14-17(28(2,3)4)13-16-9-10-26-24(23(16)22)20(12-15)25(19)27;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h5-11,13-14H,1-4H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-;/i10D;; |
| InChIKey | PKDWPELSCFIPOS-DPACJJLISA-N |
| XLogP | 10.69 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.15 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|