C25H22N2Si — CID 167365873
(15,16-dideuterio-10-methyl-1,14-diazahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaen-19-yl)-trimethylsilane (PubChem CID 167365873) has the molecular formula C25H22N2Si and a molecular weight of 380.56 g/mol. Its IUPAC name is (15,16-dideuterio-10-methyl-1,14-diazahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaen-19-yl)-trimethylsilane.
| Compound Name | (15,16-dideuterio-10-methyl-1,14-diazahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaen-19-yl)-trimethylsilane |
|---|---|
| PubChem CID | 167365873 |
| Molecular Formula | C25H22N2Si |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (15,16-dideuterio-10-methyl-1,14-diazahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaen-19-yl)-trimethylsilane |
| SMILES | [2H]c1nc2c3cc(C)cc4c5ccccc5n(c5cc([Si](C)(C)C)cc(c1[2H])c25)c43 |
| InChI | InChI=1S/C25H22N2Si/c1-15-11-19-18-7-5-6-8-21(18)27-22-14-17(28(2,3)4)13-16-9-10-26-24(23(16)22)20(12-15)25(19)27/h5-14H,1-4H3/i9D,10D |
| InChIKey | VOUFNMKWWNIUGU-QDRJLNDYSA-N |
| XLogP | 6.24 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|