C19H13N — CID 59221908
5-methyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene (PubChem CID 59221908) has the molecular formula C19H13N and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-methyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene.
| Compound Name | 5-methyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
|---|---|
| PubChem CID | 59221908 |
| Molecular Formula | C19H13N |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5-methyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
| SMILES | Cc1ccc2c(c1)c1cccc3c4ccccc4n2c31 |
| InChI | InChI=1S/C19H13N/c1-12-9-10-18-16(11-12)15-7-4-6-14-13-5-2-3-8-17(13)20(18)19(14)15/h2-11H,1H3 |
| InChIKey | HMWPKFYRPJNPGG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |