C18H11N — CID 12951299
19-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-1,3,5,7,9,11,13,15,17-nonaene (PubChem CID 12951299) has the molecular formula C18H11N and a molecular weight of 241.29 g/mol. Its IUPAC name is 19-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-1,3,5,7,9,11,13,15,17-nonaene.
| Compound Name | 19-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-1,3,5,7,9,11,13,15,17-nonaene |
|---|---|
| PubChem CID | 12951299 |
| Molecular Formula | C18H11N |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 19-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-1,3,5,7,9,11,13,15,17-nonaene |
| SMILES | c1ccc2c(c1)c1cccc3c4ccccc4c2n13 |
| InChI | InChI=1S/C18H11N/c1-3-8-14-12(6-1)16-10-5-11-17-13-7-2-4-9-15(13)18(14)19(16)17/h1-11H |
| InChIKey | HCHYGPYOIALLGZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |